C20H13F6NO4S — CID 123423275
5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 123423275) has the molecular formula C20H13F6NO4S and a molecular weight of 477.38 g/mol. Its IUPAC name is 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123423275 |
| Molecular Formula | C20H13F6NO4S |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(OCc2ccc(C(F)(F)F)cc2C(F)(F)F)ccc1C=C1SC(=O)NC1=O |
| InChI | InChI=1S/C20H13F6NO4S/c1-30-15-8-13(5-3-10(15)6-16-17(28)27-18(29)32-16)31-9-11-2-4-12(19(21,22)23)7-14(11)20(24,25)26/h2-8H,9H2,1H3,(H,27,28,29) |
| InChIKey | GRZOPEDGNQBSLP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|