C22H16F6N2O4S — CID 137092047
methyl 2-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-5-[(4-methylimino-2-oxo-1,3-thiazolidin-5-ylidene)methyl]benzoate (PubChem CID 137092047) has the molecular formula C22H16F6N2O4S and a molecular weight of 518.44 g/mol. Its IUPAC name is methyl 2-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-5-[(4-methylimino-2-oxo-1,3-thiazolidin-5-ylidene)methyl]benzoate.
| Compound Name | methyl 2-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-5-[(4-methylimino-2-oxo-1,3-thiazolidin-5-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 137092047 |
| Molecular Formula | C22H16F6N2O4S |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | methyl 2-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-5-[(4-methylimino-2-oxo-1,3-thiazolidin-5-ylidene)methyl]benzoate |
| SMILES | C/N=C1\NC(=O)SC1=Cc1ccc(OCc2ccc(C(F)(F)F)cc2C(F)(F)F)c(C(=O)OC)c1 |
| InChI | InChI=1S/C22H16F6N2O4S/c1-29-18-17(35-20(32)30-18)8-11-3-6-16(14(7-11)19(31)33-2)34-10-12-4-5-13(21(23,24)25)9-15(12)22(26,27)28/h3-9H,10H2,1-2H3,(H,29,30,32) |
| InChIKey | HUGSIYBVKORFMV-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|