C20H15F7O4 — CID 151454507
methyl (Z)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-fluoroprop-2-enoate (PubChem CID 151454507) has the molecular formula C20H15F7O4 and a molecular weight of 452.32 g/mol. Its IUPAC name is methyl (Z)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-fluoroprop-2-enoate.
| Compound Name | methyl (Z)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 151454507 |
| Molecular Formula | C20H15F7O4 |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | methyl (Z)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-fluoroprop-2-enoate |
| SMILES | COC(=O)/C(F)=C/c1ccc(OCc2ccc(C(F)(F)F)cc2C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C20H15F7O4/c1-29-17-8-11(7-15(21)18(28)30-2)3-6-16(17)31-10-12-4-5-13(19(22,23)24)9-14(12)20(25,26)27/h3-9H,10H2,1-2H3/b15-7- |
| InChIKey | PHDZJUXYRPWHFD-CHHVJCJISA-N |
| XLogP | 5.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|