C26H22F6N2O3 — CID 72813232
3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-methyl-N'-phenylprop-2-enehydrazide (PubChem CID 72813232) has the molecular formula C26H22F6N2O3 and a molecular weight of 524.46 g/mol. Its IUPAC name is 3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-methyl-N'-phenylprop-2-enehydrazide.
| Compound Name | 3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-methyl-N'-phenylprop-2-enehydrazide |
|---|---|
| PubChem CID | 72813232 |
| Molecular Formula | C26H22F6N2O3 |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-methyl-N'-phenylprop-2-enehydrazide |
| SMILES | COc1cc(C=C(C)C(=O)NNc2ccccc2)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C26H22F6N2O3/c1-16(24(35)34-33-20-6-4-3-5-7-20)12-17-8-11-22(23(13-17)36-2)37-15-18-9-10-19(25(27,28)29)14-21(18)26(30,31)32/h3-14,33H,15H2,1-2H3,(H,34,35) |
| InChIKey | NZDTYHCHPGMJRR-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|