C31H26F6N2O3S — CID 76618674
5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-(4-phenylpiperidin-1-yl)-1,3-thiazol-4-one (PubChem CID 76618674) has the molecular formula C31H26F6N2O3S and a molecular weight of 620.62 g/mol. Its IUPAC name is 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-(4-phenylpiperidin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-(4-phenylpiperidin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 76618674 |
| Molecular Formula | C31H26F6N2O3S |
| Molecular Weight | 620.62 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-(4-phenylpiperidin-1-yl)-1,3-thiazol-4-one |
| SMILES | COc1cc(C=C2SC(N3CCC(c4ccccc4)CC3)=NC2=O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C31H26F6N2O3S/c1-41-26-15-19(7-10-25(26)42-18-22-8-9-23(30(32,33)34)17-24(22)31(35,36)37)16-27-28(40)38-29(43-27)39-13-11-21(12-14-39)20-5-3-2-4-6-20/h2-10,15-17,21H,11-14,18H2,1H3 |
| InChIKey | NAYDTAQCMOUOOT-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.62 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|