C30H23Cl2F6N3O3S — CID 173123253
(5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 173123253) has the molecular formula C30H23Cl2F6N3O3S and a molecular weight of 690.49 g/mol. Its IUPAC name is (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 173123253 |
| Molecular Formula | C30H23Cl2F6N3O3S |
| Molecular Weight | 690.49 g/mol |
| Exact Mass | 689.07 |
| IUPAC Name | (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2/SC(N3CCN(c4cccc(Cl)c4Cl)CC3)=NC2=O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C30H23Cl2F6N3O3S/c1-43-24-13-17(5-8-23(24)44-16-18-6-7-19(29(33,34)35)15-20(18)30(36,37)38)14-25-27(42)39-28(45-25)41-11-9-40(10-12-41)22-4-2-3-21(31)26(22)32/h2-8,13-15H,9-12,16H2,1H3/b25-14+ |
| InChIKey | KZEVQRXBEMHCCU-AFUMVMLFSA-N |
| XLogP | 8.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.49 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|