C26H24F6N2O4S — CID 11635557
(5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-(3,5-dimethylmorpholin-4-yl)-1,3-thiazol-4-one (PubChem CID 11635557) has the molecular formula C26H24F6N2O4S and a molecular weight of 574.54 g/mol. Its IUPAC name is (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-(3,5-dimethylmorpholin-4-yl)-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-(3,5-dimethylmorpholin-4-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 11635557 |
| Molecular Formula | C26H24F6N2O4S |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-(3,5-dimethylmorpholin-4-yl)-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2/SC(N3C(C)COCC3C)=NC2=O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C26H24F6N2O4S/c1-14-11-37-12-15(2)34(14)24-33-23(35)22(39-24)9-16-4-7-20(21(8-16)36-3)38-13-17-5-6-18(25(27,28)29)10-19(17)26(30,31)32/h4-10,14-15H,11-13H2,1-3H3/b22-9+ |
| InChIKey | GZZBQLJORXOKEL-LSFURLLWSA-N |
| XLogP | 6.39 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|