C32H34F6N4O3S — CID 76618651
2-[4-[2-[bis(prop-2-enyl)amino]ethyl]piperazin-1-yl]-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 76618651) has the molecular formula C32H34F6N4O3S and a molecular weight of 668.70 g/mol. Its IUPAC name is 2-[4-[2-[bis(prop-2-enyl)amino]ethyl]piperazin-1-yl]-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-[4-[2-[bis(prop-2-enyl)amino]ethyl]piperazin-1-yl]-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 76618651 |
| Molecular Formula | C32H34F6N4O3S |
| Molecular Weight | 668.70 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | 2-[4-[2-[bis(prop-2-enyl)amino]ethyl]piperazin-1-yl]-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | C=CCN(CC=C)CCN1CCN(C2=NC(=O)C(=Cc3ccc(OCc4ccc(C(F)(F)F)cc4C(F)(F)F)c(OC)c3)S2)CC1 |
| InChI | InChI=1S/C32H34F6N4O3S/c1-4-10-40(11-5-2)12-13-41-14-16-42(17-15-41)30-39-29(43)28(46-30)19-22-6-9-26(27(18-22)44-3)45-21-23-7-8-24(31(33,34)35)20-25(23)32(36,37)38/h4-9,18-20H,1-2,10-17,21H2,3H3 |
| InChIKey | XHFIVFHKYZQHHV-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 57.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.70 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|