C30H31F6N3O5S — CID 76618680
tert-butyl N-[1-[5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidin-4-yl]carbamate (PubChem CID 76618680) has the molecular formula C30H31F6N3O5S and a molecular weight of 659.65 g/mol. Its IUPAC name is tert-butyl N-[1-[5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 76618680 |
| Molecular Formula | C30H31F6N3O5S |
| Molecular Weight | 659.65 g/mol |
| Exact Mass | 659.19 |
| IUPAC Name | tert-butyl N-[1-[5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidin-4-yl]carbamate |
| SMILES | COc1cc(C=C2SC(N3CCC(NC(=O)OC(C)(C)C)CC3)=NC2=O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C30H31F6N3O5S/c1-28(2,3)44-27(41)37-20-9-11-39(12-10-20)26-38-25(40)24(45-26)14-17-5-8-22(23(13-17)42-4)43-16-18-6-7-19(29(31,32)33)15-21(18)30(34,35)36/h5-8,13-15,20H,9-12,16H2,1-4H3,(H,37,41) |
| InChIKey | GEALZMCMRAVMJL-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.65 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|