C32H26F6N4O3S2 — CID 76618650
5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[4-(3-thiophen-2-yl-1H-pyrazol-5-yl)piperidin-1-yl]-1,3-thiazol-4-one (PubChem CID 76618650) has the molecular formula C32H26F6N4O3S2 and a molecular weight of 692.71 g/mol. Its IUPAC name is 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[4-(3-thiophen-2-yl-1H-pyrazol-5-yl)piperidin-1-yl]-1,3-thiazol-4-one.
| Compound Name | 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[4-(3-thiophen-2-yl-1H-pyrazol-5-yl)piperidin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 76618650 |
| Molecular Formula | C32H26F6N4O3S2 |
| Molecular Weight | 692.71 g/mol |
| Exact Mass | 692.14 |
| IUPAC Name | 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[4-(3-thiophen-2-yl-1H-pyrazol-5-yl)piperidin-1-yl]-1,3-thiazol-4-one |
| SMILES | COc1cc(C=C2SC(N3CCC(c4cc(-c5cccs5)n[nH]4)CC3)=NC2=O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C32H26F6N4O3S2/c1-44-26-13-18(4-7-25(26)45-17-20-5-6-21(31(33,34)35)15-22(20)32(36,37)38)14-28-29(43)39-30(47-28)42-10-8-19(9-11-42)23-16-24(41-40-23)27-3-2-12-46-27/h2-7,12-16,19H,8-11,17H2,1H3,(H,40,41) |
| InChIKey | AMBPZIUJQTVGHI-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 79.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.71 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|