C31H25F6N3O4S — CID 73020132
5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[3-(pyridine-3-carbonyl)piperidin-1-yl]-1,3-thiazol-4-one (PubChem CID 73020132) has the molecular formula C31H25F6N3O4S and a molecular weight of 649.61 g/mol. Its IUPAC name is 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[3-(pyridine-3-carbonyl)piperidin-1-yl]-1,3-thiazol-4-one.
| Compound Name | 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[3-(pyridine-3-carbonyl)piperidin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 73020132 |
| Molecular Formula | C31H25F6N3O4S |
| Molecular Weight | 649.61 g/mol |
| Exact Mass | 649.15 |
| IUPAC Name | 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[3-(pyridine-3-carbonyl)piperidin-1-yl]-1,3-thiazol-4-one |
| SMILES | COc1cc(C=C2SC(N3CCCC(C(=O)c4cccnc4)C3)=NC2=O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C31H25F6N3O4S/c1-43-25-12-18(6-9-24(25)44-17-21-7-8-22(30(32,33)34)14-23(21)31(35,36)37)13-26-28(42)39-29(45-26)40-11-3-5-20(16-40)27(41)19-4-2-10-38-15-19/h2,4,6-10,12-15,20H,3,5,11,16-17H2,1H3 |
| InChIKey | FWWKKKHCCKNCJH-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 81.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.61 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|