C25H22F6N2O4S — CID 11512431
(5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-1,3-thiazol-4-one (PubChem CID 11512431) has the molecular formula C25H22F6N2O4S and a molecular weight of 560.52 g/mol. Its IUPAC name is (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 11512431 |
| Molecular Formula | C25H22F6N2O4S |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2/SC(N3CCC[C@H]3CO)=NC2=O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H22F6N2O4S/c1-36-20-9-14(10-21-22(35)32-23(38-21)33-8-2-3-17(33)12-34)4-7-19(20)37-13-15-5-6-16(24(26,27)28)11-18(15)25(29,30)31/h4-7,9-11,17,34H,2-3,8,12-13H2,1H3/b21-10+/t17-/m0/s1 |
| InChIKey | RIQXFEGFEJMYNU-GVLJNOETSA-N |
| XLogP | 5.74 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|