C32H25F6N3O4S — CID 11592708
(5E)-2-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 11592708) has the molecular formula C32H25F6N3O4S and a molecular weight of 661.62 g/mol. Its IUPAC name is (5E)-2-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5E)-2-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 11592708 |
| Molecular Formula | C32H25F6N3O4S |
| Molecular Weight | 661.62 g/mol |
| Exact Mass | 661.15 |
| IUPAC Name | (5E)-2-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2/SC(N3CCC(c4nc5ccccc5o4)CC3)=NC2=O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C32H25F6N3O4S/c1-43-26-14-18(6-9-25(26)44-17-20-7-8-21(31(33,34)35)16-22(20)32(36,37)38)15-27-28(42)40-30(46-27)41-12-10-19(11-13-41)29-39-23-4-2-3-5-24(23)45-29/h2-9,14-16,19H,10-13,17H2,1H3/b27-15+ |
| InChIKey | DRXKYNIKMIHXQM-JFLMPSFJSA-N |
| XLogP | 8.30 |
| TPSA | 77.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.62 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|