C24H20F6N2O3S — CID 11598996
(5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one (PubChem CID 11598996) has the molecular formula C24H20F6N2O3S and a molecular weight of 530.49 g/mol. Its IUPAC name is (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 11598996 |
| Molecular Formula | C24H20F6N2O3S |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2/SC(N3CCCC3)=NC2=O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H20F6N2O3S/c1-34-19-10-14(11-20-21(33)31-22(36-20)32-8-2-3-9-32)4-7-18(19)35-13-15-5-6-16(23(25,26)27)12-17(15)24(28,29)30/h4-7,10-12H,2-3,8-9,13H2,1H3/b20-11+ |
| InChIKey | BEFHCTJNBBMGGH-RGVLZGJSSA-N |
| XLogP | 6.38 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|