C25H22F6N2O6 — CID 151393167
3-[2-[[(E)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]ethoxy]propanoic acid (PubChem CID 151393167) has the molecular formula C25H22F6N2O6 and a molecular weight of 560.45 g/mol. Its IUPAC name is 3-[2-[[(E)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]ethoxy]propanoic acid.
| Compound Name | 3-[2-[[(E)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 151393167 |
| Molecular Formula | C25H22F6N2O6 |
| Molecular Weight | 560.45 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 3-[2-[[(E)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]ethoxy]propanoic acid |
| SMILES | COc1cc(/C=C(\C#N)C(=O)NCCOCCC(=O)O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H22F6N2O6/c1-37-21-11-15(10-17(13-32)23(36)33-7-9-38-8-6-22(34)35)2-5-20(21)39-14-16-3-4-18(24(26,27)28)12-19(16)25(29,30)31/h2-5,10-12H,6-9,14H2,1H3,(H,33,36)(H,34,35)/b17-10+ |
| InChIKey | OUWPLANKBAZARJ-LICLKQGHSA-N |
| XLogP | 4.83 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|