C22H22Cl2N2O4 — CID 35746608
(E)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(3-methoxypropyl)prop-2-enamide (PubChem CID 35746608) has the molecular formula C22H22Cl2N2O4 and a molecular weight of 449.33 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(3-methoxypropyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(3-methoxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 35746608 |
| Molecular Formula | C22H22Cl2N2O4 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (E)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(3-methoxypropyl)prop-2-enamide |
| SMILES | COCCCNC(=O)/C(C#N)=C/c1ccc(OCc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C22H22Cl2N2O4/c1-28-9-3-8-26-22(27)17(13-25)10-15-4-7-20(21(11-15)29-2)30-14-16-5-6-18(23)12-19(16)24/h4-7,10-12H,3,8-9,14H2,1-2H3,(H,26,27)/b17-10+ |
| InChIKey | NIWRKZWYZDHZDY-LICLKQGHSA-N |
| XLogP | 4.64 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|