C22H21ClN2O6 — CID 19179853
[4-[(E)-2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-(3-chlorophenoxy)acetate (PubChem CID 19179853) has the molecular formula C22H21ClN2O6 and a molecular weight of 444.87 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-(3-chlorophenoxy)acetate.
| Compound Name | [4-[(E)-2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-(3-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 19179853 |
| Molecular Formula | C22H21ClN2O6 |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [4-[(E)-2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-(3-chlorophenoxy)acetate |
| SMILES | COCCNC(=O)/C(C#N)=C/c1ccc(OC(=O)COc2cccc(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C22H21ClN2O6/c1-28-9-8-25-22(27)16(13-24)10-15-6-7-19(20(11-15)29-2)31-21(26)14-30-18-5-3-4-17(23)12-18/h3-7,10-12H,8-9,14H2,1-2H3,(H,25,27)/b16-10+ |
| InChIKey | IOLGHZKOIDDOGJ-MHWRWJLKSA-N |
| XLogP | 3.00 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|