C15H18N2O3 — CID 124625870
(E)-2-cyano-3-(3-ethoxyphenyl)-N-(2-methoxyethyl)prop-2-enamide (PubChem CID 124625870) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (E)-2-cyano-3-(3-ethoxyphenyl)-N-(2-methoxyethyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3-ethoxyphenyl)-N-(2-methoxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 124625870 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (E)-2-cyano-3-(3-ethoxyphenyl)-N-(2-methoxyethyl)prop-2-enamide |
| SMILES | CCOc1cccc(/C=C(\C#N)C(=O)NCCOC)c1 |
| InChI | InChI=1S/C15H18N2O3/c1-3-20-14-6-4-5-12(10-14)9-13(11-16)15(18)17-7-8-19-2/h4-6,9-10H,3,7-8H2,1-2H3,(H,17,18)/b13-9+ |
| InChIKey | VWICACLWDSPUIC-UKTHLTGXSA-N |
| XLogP | 1.75 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|