C24H28BN3O6 — CID 174106029
[1-[3-[3-[2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenoxy]propanoylamino]-2-phenylethyl]boronic acid (PubChem CID 174106029) has the molecular formula C24H28BN3O6 and a molecular weight of 465.32 g/mol. Its IUPAC name is [1-[3-[3-[2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenoxy]propanoylamino]-2-phenylethyl]boronic acid.
| Compound Name | [1-[3-[3-[2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenoxy]propanoylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 174106029 |
| Molecular Formula | C24H28BN3O6 |
| Molecular Weight | 465.32 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | [1-[3-[3-[2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenoxy]propanoylamino]-2-phenylethyl]boronic acid |
| SMILES | COCCNC(=O)C(C#N)=Cc1cccc(OCCC(=O)NC(Cc2ccccc2)B(O)O)c1 |
| InChI | InChI=1S/C24H28BN3O6/c1-33-13-11-27-24(30)20(17-26)14-19-8-5-9-21(15-19)34-12-10-23(29)28-22(25(31)32)16-18-6-3-2-4-7-18/h2-9,14-15,22,31-32H,10-13,16H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | BXJRNAVLXWZEKQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 140.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|