C21H20N2O4 — CID 76877981
3-[3-[2-cyano-3-oxo-3-(2-phenylethylamino)prop-1-enyl]phenoxy]propanoic acid (PubChem CID 76877981) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-[3-[2-cyano-3-oxo-3-(2-phenylethylamino)prop-1-enyl]phenoxy]propanoic acid.
| Compound Name | 3-[3-[2-cyano-3-oxo-3-(2-phenylethylamino)prop-1-enyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 76877981 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 3-[3-[2-cyano-3-oxo-3-(2-phenylethylamino)prop-1-enyl]phenoxy]propanoic acid |
| SMILES | N#CC(=Cc1cccc(OCCC(=O)O)c1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C21H20N2O4/c22-15-18(21(26)23-11-9-16-5-2-1-3-6-16)13-17-7-4-8-19(14-17)27-12-10-20(24)25/h1-8,13-14H,9-12H2,(H,23,26)(H,24,25) |
| InChIKey | JASZOGQQYGCWRX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|