C25H21N3O3 — CID 126273579
(E)-3-[3-(2-anilino-2-oxoethoxy)phenyl]-N-benzyl-2-cyanoprop-2-enamide (PubChem CID 126273579) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is (E)-3-[3-(2-anilino-2-oxoethoxy)phenyl]-N-benzyl-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[3-(2-anilino-2-oxoethoxy)phenyl]-N-benzyl-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126273579 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (E)-3-[3-(2-anilino-2-oxoethoxy)phenyl]-N-benzyl-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1cccc(OCC(=O)Nc2ccccc2)c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H21N3O3/c26-16-21(25(30)27-17-19-8-3-1-4-9-19)14-20-10-7-13-23(15-20)31-18-24(29)28-22-11-5-2-6-12-22/h1-15H,17-18H2,(H,27,30)(H,28,29)/b21-14+ |
| InChIKey | UODBFSCYXYZLSB-KGENOOAVSA-N |
| XLogP | 3.93 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|