C24H17Cl2N3O4 — CID 6186093
(E)-2-cyano-3-[3-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 6186093) has the molecular formula C24H17Cl2N3O4 and a molecular weight of 482.32 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6186093 |
| Molecular Formula | C24H17Cl2N3O4 |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | (E)-2-cyano-3-[3-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cccc(OCC(=O)Nc2ccc(Cl)c(Cl)c2)c1)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C24H17Cl2N3O4/c25-21-9-6-18(12-22(21)26)28-23(31)14-33-20-3-1-2-15(11-20)10-16(13-27)24(32)29-17-4-7-19(30)8-5-17/h1-12,30H,14H2,(H,28,31)(H,29,32)/b16-10+ |
| InChIKey | KOQJXPRVLYTWFT-MHWRWJLKSA-N |
| XLogP | 5.26 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|