C26H21Cl2N3O3 — CID 124549283
(Z)-2-cyano-N-(3,4-dichlorophenyl)-3-[3-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]prop-2-enamide (PubChem CID 124549283) has the molecular formula C26H21Cl2N3O3 and a molecular weight of 494.38 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-[3-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-[3-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 124549283 |
| Molecular Formula | C26H21Cl2N3O3 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-[3-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)COc2cccc(/C=C(/C#N)C(=O)Nc3ccc(Cl)c(Cl)c3)c2)cc1C |
| InChI | InChI=1S/C26H21Cl2N3O3/c1-16-6-7-20(10-17(16)2)30-25(32)15-34-22-5-3-4-18(12-22)11-19(14-29)26(33)31-21-8-9-23(27)24(28)13-21/h3-13H,15H2,1-2H3,(H,30,32)(H,31,33)/b19-11- |
| InChIKey | QENQNDOYYJADOL-ODLFYWEKSA-N |
| XLogP | 6.17 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|