C25H20ClN3O3 — CID 126232859
(Z)-3-[3-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(2-methylphenyl)prop-2-enamide (PubChem CID 126232859) has the molecular formula C25H20ClN3O3 and a molecular weight of 445.91 g/mol. Its IUPAC name is (Z)-3-[3-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(2-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126232859 |
| Molecular Formula | C25H20ClN3O3 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | (Z)-3-[3-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C\c1cccc(OCC(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C25H20ClN3O3/c1-17-5-2-3-8-23(17)29-25(31)19(15-27)13-18-6-4-7-22(14-18)32-16-24(30)28-21-11-9-20(26)10-12-21/h2-14H,16H2,1H3,(H,28,30)(H,29,31)/b19-13- |
| InChIKey | QPWMLYLMWWPLKR-UYRXBGFRSA-N |
| XLogP | 5.21 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|