C27H23N3O5 — CID 126226567
methyl 4-[[(Z)-2-cyano-3-[3-[2-(4-methylanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate (PubChem CID 126226567) has the molecular formula C27H23N3O5 and a molecular weight of 469.50 g/mol. Its IUPAC name is methyl 4-[[(Z)-2-cyano-3-[3-[2-(4-methylanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-2-cyano-3-[3-[2-(4-methylanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 126226567 |
| Molecular Formula | C27H23N3O5 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | methyl 4-[[(Z)-2-cyano-3-[3-[2-(4-methylanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)/C(C#N)=C\c2cccc(OCC(=O)Nc3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C27H23N3O5/c1-18-6-10-22(11-7-18)29-25(31)17-35-24-5-3-4-19(15-24)14-21(16-28)26(32)30-23-12-8-20(9-13-23)27(33)34-2/h3-15H,17H2,1-2H3,(H,29,31)(H,30,32)/b21-14- |
| InChIKey | XYTHKIOAOIZBJX-STZFKDTASA-N |
| XLogP | 4.34 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|