C27H23N3O6 — CID 3295588
methyl 4-[[2-cyano-3-[3-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate (PubChem CID 3295588) has the molecular formula C27H23N3O6 and a molecular weight of 485.50 g/mol. Its IUPAC name is methyl 4-[[2-cyano-3-[3-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[2-cyano-3-[3-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 3295588 |
| Molecular Formula | C27H23N3O6 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | methyl 4-[[2-cyano-3-[3-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(C#N)=Cc2cccc(OCC(=O)Nc3ccccc3OC)c2)cc1 |
| InChI | InChI=1S/C27H23N3O6/c1-34-24-9-4-3-8-23(24)30-25(31)17-36-22-7-5-6-18(15-22)14-20(16-28)26(32)29-21-12-10-19(11-13-21)27(33)35-2/h3-15H,17H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | MIMUPMUKQJGBQJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|