C26H20FN3O5 — CID 126380340
methyl 4-[[(Z)-2-cyano-3-[4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate (PubChem CID 126380340) has the molecular formula C26H20FN3O5 and a molecular weight of 473.46 g/mol. Its IUPAC name is methyl 4-[[(Z)-2-cyano-3-[4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-2-cyano-3-[4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 126380340 |
| Molecular Formula | C26H20FN3O5 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | methyl 4-[[(Z)-2-cyano-3-[4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)/C(C#N)=C\c2ccc(OCC(=O)Nc3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C26H20FN3O5/c1-34-26(33)18-8-10-20(11-9-18)29-25(32)19(15-28)14-17-6-12-21(13-7-17)35-16-24(31)30-23-5-3-2-4-22(23)27/h2-14H,16H2,1H3,(H,29,32)(H,30,31)/b19-14- |
| InChIKey | OWLRXZHNQKQXLD-RGEXLXHISA-N |
| XLogP | 4.18 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|