C24H17FN2O3 — CID 4581544
[4-[2-cyano-3-(2-fluoroanilino)-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate (PubChem CID 4581544) has the molecular formula C24H17FN2O3 and a molecular weight of 400.41 g/mol. Its IUPAC name is [4-[2-cyano-3-(2-fluoroanilino)-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[2-cyano-3-(2-fluoroanilino)-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 4581544 |
| Molecular Formula | C24H17FN2O3 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [4-[2-cyano-3-(2-fluoroanilino)-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C=C(C#N)C(=O)Nc3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C24H17FN2O3/c1-16-6-10-18(11-7-16)24(29)30-20-12-8-17(9-13-20)14-19(15-26)23(28)27-22-5-3-2-4-21(22)25/h2-14H,1H3,(H,27,28) |
| InChIKey | QTSIKABOFYDZCO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|