C22H23FN2O2 — CID 3645178
2-cyano-N-(2-fluorophenyl)-3-(4-hexoxyphenyl)prop-2-enamide (PubChem CID 3645178) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-cyano-N-(2-fluorophenyl)-3-(4-hexoxyphenyl)prop-2-enamide.
| Compound Name | 2-cyano-N-(2-fluorophenyl)-3-(4-hexoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3645178 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-cyano-N-(2-fluorophenyl)-3-(4-hexoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCOc1ccc(C=C(C#N)C(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C22H23FN2O2/c1-2-3-4-7-14-27-19-12-10-17(11-13-19)15-18(16-24)22(26)25-21-9-6-5-8-20(21)23/h5-6,8-13,15H,2-4,7,14H2,1H3,(H,25,26) |
| InChIKey | DVNWYZYZUMYGKX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|