C20H27NO3 — CID 43833928
(E)-2-cyano-3-(4-decoxyphenyl)prop-2-enoic acid (PubChem CID 43833928) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (E)-2-cyano-3-(4-decoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-(4-decoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 43833928 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (E)-2-cyano-3-(4-decoxyphenyl)prop-2-enoic acid |
| SMILES | CCCCCCCCCCOc1ccc(/C=C(\C#N)C(=O)O)cc1 |
| InChI | InChI=1S/C20H27NO3/c1-2-3-4-5-6-7-8-9-14-24-19-12-10-17(11-13-19)15-18(16-21)20(22)23/h10-13,15H,2-9,14H2,1H3,(H,22,23)/b18-15+ |
| InChIKey | BZVGGENWPBJMJC-OBGWFSINSA-N |
| XLogP | 5.20 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|