C19H24N2O4 — CID 102425104
ethyl N-[(E)-2-cyano-3-(4-hexoxyphenyl)prop-2-enoyl]carbamate (PubChem CID 102425104) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is ethyl N-[(E)-2-cyano-3-(4-hexoxyphenyl)prop-2-enoyl]carbamate.
| Compound Name | ethyl N-[(E)-2-cyano-3-(4-hexoxyphenyl)prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 102425104 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | ethyl N-[(E)-2-cyano-3-(4-hexoxyphenyl)prop-2-enoyl]carbamate |
| SMILES | CCCCCCOc1ccc(/C=C(\C#N)C(=O)NC(=O)OCC)cc1 |
| InChI | InChI=1S/C19H24N2O4/c1-3-5-6-7-12-25-17-10-8-15(9-11-17)13-16(14-20)18(22)21-19(23)24-4-2/h8-11,13H,3-7,12H2,1-2H3,(H,21,22,23)/b16-13+ |
| InChIKey | PTKBWTMKGRIOTN-DTQAZKPQSA-N |
| XLogP | 3.83 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|