C14H14N2O4 — CID 3903053
ethyl N-[2-cyano-3-(4-methoxyphenyl)prop-2-enoyl]carbamate (PubChem CID 3903053) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is ethyl N-[2-cyano-3-(4-methoxyphenyl)prop-2-enoyl]carbamate.
| Compound Name | ethyl N-[2-cyano-3-(4-methoxyphenyl)prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 3903053 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | ethyl N-[2-cyano-3-(4-methoxyphenyl)prop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H14N2O4/c1-3-20-14(18)16-13(17)11(9-15)8-10-4-6-12(19-2)7-5-10/h4-8H,3H2,1-2H3,(H,16,17,18) |
| InChIKey | LKOZTPDPKOXFIE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|