About ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate
ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate (PubChem CID 177431632) has the molecular formula C16H18N2O6
and a molecular weight of 334.33 g/mol. Its IUPAC name is ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate |
| PubChem CID | 177431632 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=C\c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H18N2O6/c1-5-24-16(20)18-15(19)11(9-17)6-10-7-12(21-2)14(23-4)13(8-10)22-3/h6-8H,5H2,1-4H3,(H,18,19,20)/b11-6- |
| InChIKey | XWOSRUOGIMWLFO-WDZFZDKYSA-N |
| XLogP | 1.89 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate?
The IUPAC name of ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate (CID 177431632) is ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate.
What is the SMILES notation for ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate?
The canonical SMILES for ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate is CCOC(=O)NC(=O)/C(C#N)=C\c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate?
The InChIKey is XWOSRUOGIMWLFO-WDZFZDKYSA-N. The full InChI is InChI=1S/C16H18N2O6/c1-5-24-16(20)18-15(19)11(9-17)6-10-7-12(21-2)14(23-4)13(8-10)22-3/h6-8H,5H2,1-4H3,(H,18,19,20)/b11-6-.
What are the key properties of ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate?
ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate has a molecular weight of 334.33 g/mol, XLogP of 1.89, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(Z)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]carbamate is sourced from PubChem (CID 177431632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).