C7H8N2O4 — CID 143550821
ethyl N-[(Z)-2-cyano-3-hydroxyprop-2-enoyl]carbamate (PubChem CID 143550821) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is ethyl N-[(Z)-2-cyano-3-hydroxyprop-2-enoyl]carbamate.
| Compound Name | ethyl N-[(Z)-2-cyano-3-hydroxyprop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 143550821 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | ethyl N-[(Z)-2-cyano-3-hydroxyprop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=C\O |
| InChI | InChI=1S/C7H8N2O4/c1-2-13-7(12)9-6(11)5(3-8)4-10/h4,10H,2H2,1H3,(H,9,11,12)/b5-4- |
| InChIKey | NBNUNEIBXFVEOT-PLNGDYQASA-N |
| XLogP | 0.22 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|