C13H10Cl3N3O3 — CID 13014428
ethyl N-[(E)-2-cyano-3-(2,4,6-trichloroanilino)prop-2-enoyl]carbamate (PubChem CID 13014428) has the molecular formula C13H10Cl3N3O3 and a molecular weight of 362.60 g/mol. Its IUPAC name is ethyl N-[(E)-2-cyano-3-(2,4,6-trichloroanilino)prop-2-enoyl]carbamate.
| Compound Name | ethyl N-[(E)-2-cyano-3-(2,4,6-trichloroanilino)prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 13014428 |
| Molecular Formula | C13H10Cl3N3O3 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | ethyl N-[(E)-2-cyano-3-(2,4,6-trichloroanilino)prop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=C/Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3N3O3/c1-2-22-13(21)19-12(20)7(5-17)6-18-11-9(15)3-8(14)4-10(11)16/h3-4,6,18H,2H2,1H3,(H,19,20,21)/b7-6+ |
| InChIKey | MQDFRLLFOHCCKN-VOTSOKGWSA-N |
| XLogP | 3.74 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|