C13H10Cl2FN3O4 — CID 170120348
ethyl N-[(Z)-2-cyano-3-(3,5-dichloro-4-fluorooxyanilino)prop-2-enoyl]carbamate (PubChem CID 170120348) has the molecular formula C13H10Cl2FN3O4 and a molecular weight of 362.14 g/mol. Its IUPAC name is ethyl N-[(Z)-2-cyano-3-(3,5-dichloro-4-fluorooxyanilino)prop-2-enoyl]carbamate.
| Compound Name | ethyl N-[(Z)-2-cyano-3-(3,5-dichloro-4-fluorooxyanilino)prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 170120348 |
| Molecular Formula | C13H10Cl2FN3O4 |
| Molecular Weight | 362.14 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | ethyl N-[(Z)-2-cyano-3-(3,5-dichloro-4-fluorooxyanilino)prop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=C\Nc1cc(Cl)c(OF)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2FN3O4/c1-2-22-13(21)19-12(20)7(5-17)6-18-8-3-9(14)11(23-16)10(15)4-8/h3-4,6,18H,2H2,1H3,(H,19,20,21)/b7-6- |
| InChIKey | CXLZLPQJMBQFTA-SREVYHEPSA-N |
| XLogP | 3.35 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|