C16H15ClFN3O5S — CID 5188363
methyl 2-[5-chloro-2-[[2-cyano-3-(ethoxycarbonylamino)-3-oxoprop-1-enyl]amino]-3-fluorophenyl]sulfanylacetate (PubChem CID 5188363) has the molecular formula C16H15ClFN3O5S and a molecular weight of 415.83 g/mol. Its IUPAC name is methyl 2-[5-chloro-2-[[2-cyano-3-(ethoxycarbonylamino)-3-oxoprop-1-enyl]amino]-3-fluorophenyl]sulfanylacetate.
| Compound Name | methyl 2-[5-chloro-2-[[2-cyano-3-(ethoxycarbonylamino)-3-oxoprop-1-enyl]amino]-3-fluorophenyl]sulfanylacetate |
|---|---|
| PubChem CID | 5188363 |
| Molecular Formula | C16H15ClFN3O5S |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | methyl 2-[5-chloro-2-[[2-cyano-3-(ethoxycarbonylamino)-3-oxoprop-1-enyl]amino]-3-fluorophenyl]sulfanylacetate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=CNc1c(F)cc(Cl)cc1SCC(=O)OC |
| InChI | InChI=1S/C16H15ClFN3O5S/c1-3-26-16(24)21-15(23)9(6-19)7-20-14-11(18)4-10(17)5-12(14)27-8-13(22)25-2/h4-5,7,20H,3,8H2,1-2H3,(H,21,23,24) |
| InChIKey | LBCYLHAKDQCSCO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|