C13H13N3O5S — CID 3274265
methyl 2-[[2-cyano-3-(ethoxycarbonylamino)-3-oxoprop-1-enyl]amino]thiophene-3-carboxylate (PubChem CID 3274265) has the molecular formula C13H13N3O5S and a molecular weight of 323.33 g/mol. Its IUPAC name is methyl 2-[[2-cyano-3-(ethoxycarbonylamino)-3-oxoprop-1-enyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-cyano-3-(ethoxycarbonylamino)-3-oxoprop-1-enyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3274265 |
| Molecular Formula | C13H13N3O5S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | methyl 2-[[2-cyano-3-(ethoxycarbonylamino)-3-oxoprop-1-enyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=CNc1sccc1C(=O)OC |
| InChI | InChI=1S/C13H13N3O5S/c1-3-21-13(19)16-10(17)8(6-14)7-15-11-9(4-5-22-11)12(18)20-2/h4-5,7,15H,3H2,1-2H3,(H,16,17,19) |
| InChIKey | SEWBIHQFHZCAJE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|