C18H22F3N3O3 — CID 144521542
ethane;ethene;ethyl N-[(Z)-2-cyano-3-[3-(trifluoromethyl)anilino]prop-2-enoyl]carbamate (PubChem CID 144521542) has the molecular formula C18H22F3N3O3 and a molecular weight of 385.39 g/mol. Its IUPAC name is ethane;ethene;ethyl N-[(Z)-2-cyano-3-[3-(trifluoromethyl)anilino]prop-2-enoyl]carbamate.
| Compound Name | ethane;ethene;ethyl N-[(Z)-2-cyano-3-[3-(trifluoromethyl)anilino]prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 144521542 |
| Molecular Formula | C18H22F3N3O3 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | ethane;ethene;ethyl N-[(Z)-2-cyano-3-[3-(trifluoromethyl)anilino]prop-2-enoyl]carbamate |
| SMILES | C=C.CC.CCOC(=O)NC(=O)/C(C#N)=C\Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F3N3O3.C2H6.C2H4/c1-2-23-13(22)20-12(21)9(7-18)8-19-11-5-3-4-10(6-11)14(15,16)17;2*1-2/h3-6,8,19H,2H2,1H3,(H,20,21,22);1-2H3;1-2H2/b9-8-;; |
| InChIKey | BKVGXCGOJVGQDX-ULDSSAIZSA-N |
| XLogP | 4.63 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|