C17H18F3N3O6 — CID 45034304
ethyl N-[2-(ethoxycarbonylcarbamoyl)-3-[3-(trifluoromethyl)anilino]prop-2-enoyl]carbamate (PubChem CID 45034304) has the molecular formula C17H18F3N3O6 and a molecular weight of 417.34 g/mol. Its IUPAC name is ethyl N-[2-(ethoxycarbonylcarbamoyl)-3-[3-(trifluoromethyl)anilino]prop-2-enoyl]carbamate.
| Compound Name | ethyl N-[2-(ethoxycarbonylcarbamoyl)-3-[3-(trifluoromethyl)anilino]prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 45034304 |
| Molecular Formula | C17H18F3N3O6 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | ethyl N-[2-(ethoxycarbonylcarbamoyl)-3-[3-(trifluoromethyl)anilino]prop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(=CNc1cccc(C(F)(F)F)c1)C(=O)NC(=O)OCC |
| InChI | InChI=1S/C17H18F3N3O6/c1-3-28-15(26)22-13(24)12(14(25)23-16(27)29-4-2)9-21-11-7-5-6-10(8-11)17(18,19)20/h5-9,21H,3-4H2,1-2H3,(H,22,24,26)(H,23,25,27) |
| InChIKey | NUJKKNFFHFINAI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|