C14H18N2O4 — CID 13394075
diethyl 2-[(3-aminoanilino)methylidene]propanedioate (PubChem CID 13394075) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is diethyl 2-[(3-aminoanilino)methylidene]propanedioate.
| Compound Name | diethyl 2-[(3-aminoanilino)methylidene]propanedioate |
|---|---|
| PubChem CID | 13394075 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | diethyl 2-[(3-aminoanilino)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1cccc(N)c1)C(=O)OCC |
| InChI | InChI=1S/C14H18N2O4/c1-3-19-13(17)12(14(18)20-4-2)9-16-11-7-5-6-10(15)8-11/h5-9,16H,3-4,15H2,1-2H3 |
| InChIKey | FVKLFLFDTAEQRX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|