About diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen
diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen (PubChem CID 159284802) has the molecular formula C15H20FNO5
and a molecular weight of 313.33 g/mol. Its IUPAC name is diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen.
Molecular Properties
| Compound Name | diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen |
| PubChem CID | 159284802 |
| Molecular Formula | C15H20FNO5 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen |
| SMILES | CCOC(=O)C(=CNc1ccc(F)c(OC)c1)C(=O)OCC.[H][H] |
| InChI | InChI=1S/C15H18FNO5.H2/c1-4-21-14(18)11(15(19)22-5-2)9-17-10-6-7-12(16)13(8-10)20-3;/h6-9,17H,4-5H2,1-3H3;1H |
| InChIKey | KZJLANUFUNMLBG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen?
The IUPAC name of diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen (CID 159284802) is diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen.
What is the SMILES notation for diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen?
The canonical SMILES for diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen is CCOC(=O)C(=CNc1ccc(F)c(OC)c1)C(=O)OCC.[H][H].
What is the InChIKey of diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen?
The InChIKey is KZJLANUFUNMLBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FNO5.H2/c1-4-21-14(18)11(15(19)22-5-2)9-17-10-6-7-12(16)13(8-10)20-3;/h6-9,17H,4-5H2,1-3H3;1H.
What are the key properties of diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen?
diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen has a molecular weight of 313.33 g/mol, XLogP of 2.50, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(4-fluoro-3-methoxyanilino)methylidene]propanedioate;molecular hydrogen is sourced from PubChem (CID 159284802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).