C16H20N2O5 — CID 2485674
diethyl 2-[(3-acetamidoanilino)methylidene]propanedioate (PubChem CID 2485674) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is diethyl 2-[(3-acetamidoanilino)methylidene]propanedioate.
| Compound Name | diethyl 2-[(3-acetamidoanilino)methylidene]propanedioate |
|---|---|
| PubChem CID | 2485674 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | diethyl 2-[(3-acetamidoanilino)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1cccc(NC(C)=O)c1)C(=O)OCC |
| InChI | InChI=1S/C16H20N2O5/c1-4-22-15(20)14(16(21)23-5-2)10-17-12-7-6-8-13(9-12)18-11(3)19/h6-10,17H,4-5H2,1-3H3,(H,18,19) |
| InChIKey | FYKKLYBVKXLVII-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|