C22H24N2O5 — CID 11610943
diethyl 2-[[3-(benzylcarbamoyl)anilino]methylidene]propanedioate (PubChem CID 11610943) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is diethyl 2-[[3-(benzylcarbamoyl)anilino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[3-(benzylcarbamoyl)anilino]methylidene]propanedioate |
|---|---|
| PubChem CID | 11610943 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | diethyl 2-[[3-(benzylcarbamoyl)anilino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1cccc(C(=O)NCc2ccccc2)c1)C(=O)OCC |
| InChI | InChI=1S/C22H24N2O5/c1-3-28-21(26)19(22(27)29-4-2)15-23-18-12-8-11-17(13-18)20(25)24-14-16-9-6-5-7-10-16/h5-13,15,23H,3-4,14H2,1-2H3,(H,24,25) |
| InChIKey | IRVJMCZMDUXUOM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|