C27H27N3O4 — CID 70109243
ethyl (E)-3-[3-[[[3-(benzylcarbamoylamino)benzoyl]amino]methyl]phenyl]prop-2-enoate (PubChem CID 70109243) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is ethyl (E)-3-[3-[[[3-(benzylcarbamoylamino)benzoyl]amino]methyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[[[3-(benzylcarbamoylamino)benzoyl]amino]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 70109243 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | ethyl (E)-3-[3-[[[3-(benzylcarbamoylamino)benzoyl]amino]methyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc(CNC(=O)c2cccc(NC(=O)NCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C27H27N3O4/c1-2-34-25(31)15-14-20-10-6-11-22(16-20)19-28-26(32)23-12-7-13-24(17-23)30-27(33)29-18-21-8-4-3-5-9-21/h3-17H,2,18-19H2,1H3,(H,28,32)(H2,29,30,33)/b15-14+ |
| InChIKey | FQNWZBWXODNDOU-CCEZHUSRSA-N |
| XLogP | 4.51 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|