C31H29N3O4 — CID 19076827
3-[3-[[[3-(benzylcarbamoylamino)benzoyl]amino]methyl]phenyl]-3-phenylpropanoic acid (PubChem CID 19076827) has the molecular formula C31H29N3O4 and a molecular weight of 507.59 g/mol. Its IUPAC name is 3-[3-[[[3-(benzylcarbamoylamino)benzoyl]amino]methyl]phenyl]-3-phenylpropanoic acid.
| Compound Name | 3-[3-[[[3-(benzylcarbamoylamino)benzoyl]amino]methyl]phenyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 19076827 |
| Molecular Formula | C31H29N3O4 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 3-[3-[[[3-(benzylcarbamoylamino)benzoyl]amino]methyl]phenyl]-3-phenylpropanoic acid |
| SMILES | O=C(O)CC(c1ccccc1)c1cccc(CNC(=O)c2cccc(NC(=O)NCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C31H29N3O4/c35-29(36)19-28(24-12-5-2-6-13-24)25-14-7-11-23(17-25)21-32-30(37)26-15-8-16-27(18-26)34-31(38)33-20-22-9-3-1-4-10-22/h1-18,28H,19-21H2,(H,32,37)(H,35,36)(H2,33,34,38) |
| InChIKey | VKCIYLWNANUJCR-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |