C37H40N4O4 — CID 43887216
N,N'-bis[3-(benzylcarbamoyl)phenyl]nonanediamide (PubChem CID 43887216) has the molecular formula C37H40N4O4 and a molecular weight of 604.75 g/mol. Its IUPAC name is N,N'-bis[3-(benzylcarbamoyl)phenyl]nonanediamide.
| Compound Name | N,N'-bis[3-(benzylcarbamoyl)phenyl]nonanediamide |
|---|---|
| PubChem CID | 43887216 |
| Molecular Formula | C37H40N4O4 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | N,N'-bis[3-(benzylcarbamoyl)phenyl]nonanediamide |
| SMILES | O=C(CCCCCCCC(=O)Nc1cccc(C(=O)NCc2ccccc2)c1)Nc1cccc(C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C37H40N4O4/c42-34(40-32-20-12-18-30(24-32)36(44)38-26-28-14-6-4-7-15-28)22-10-2-1-3-11-23-35(43)41-33-21-13-19-31(25-33)37(45)39-27-29-16-8-5-9-17-29/h4-9,12-21,24-25H,1-3,10-11,22-23,26-27H2,(H,38,44)(H,39,45)(H,40,42)(H,41,43) |
| InChIKey | RRZKZQTZDNDZIB-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|