C30H27N3O5S — CID 22268453
3-[2-[[3-(benzylcarbamoylamino)benzoyl]amino]phenyl]sulfinyl-3-phenylpropanoic acid (PubChem CID 22268453) has the molecular formula C30H27N3O5S and a molecular weight of 541.63 g/mol. Its IUPAC name is 3-[2-[[3-(benzylcarbamoylamino)benzoyl]amino]phenyl]sulfinyl-3-phenylpropanoic acid.
| Compound Name | 3-[2-[[3-(benzylcarbamoylamino)benzoyl]amino]phenyl]sulfinyl-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22268453 |
| Molecular Formula | C30H27N3O5S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 3-[2-[[3-(benzylcarbamoylamino)benzoyl]amino]phenyl]sulfinyl-3-phenylpropanoic acid |
| SMILES | O=C(O)CC(c1ccccc1)S(=O)c1ccccc1NC(=O)c1cccc(NC(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C30H27N3O5S/c34-28(35)19-27(22-12-5-2-6-13-22)39(38)26-17-8-7-16-25(26)33-29(36)23-14-9-15-24(18-23)32-30(37)31-20-21-10-3-1-4-11-21/h1-18,27H,19-20H2,(H,33,36)(H,34,35)(H2,31,32,37) |
| InChIKey | RKRNPNOXIFLXMY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |