C23H21N3O4S — CID 10181425
3-[2-[[3-(carbamoylamino)benzoyl]amino]phenyl]sulfanyl-3-phenylpropanoic acid (PubChem CID 10181425) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is 3-[2-[[3-(carbamoylamino)benzoyl]amino]phenyl]sulfanyl-3-phenylpropanoic acid.
| Compound Name | 3-[2-[[3-(carbamoylamino)benzoyl]amino]phenyl]sulfanyl-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10181425 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 3-[2-[[3-(carbamoylamino)benzoyl]amino]phenyl]sulfanyl-3-phenylpropanoic acid |
| SMILES | NC(=O)Nc1cccc(C(=O)Nc2ccccc2SC(CC(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H21N3O4S/c24-23(30)25-17-10-6-9-16(13-17)22(29)26-18-11-4-5-12-19(18)31-20(14-21(27)28)15-7-2-1-3-8-15/h1-13,20H,14H2,(H,26,29)(H,27,28)(H3,24,25,30) |
| InChIKey | UPIIQPJUCRYWSB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |