C17H18N4O3 — CID 38205035
N-(2-benzamidoethyl)-3-(carbamoylamino)benzamide (PubChem CID 38205035) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-3-(carbamoylamino)benzamide.
| Compound Name | N-(2-benzamidoethyl)-3-(carbamoylamino)benzamide |
|---|---|
| PubChem CID | 38205035 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-(2-benzamidoethyl)-3-(carbamoylamino)benzamide |
| SMILES | NC(=O)Nc1cccc(C(=O)NCCNC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H18N4O3/c18-17(24)21-14-8-4-7-13(11-14)16(23)20-10-9-19-15(22)12-5-2-1-3-6-12/h1-8,11H,9-10H2,(H,19,22)(H,20,23)(H3,18,21,24) |
| InChIKey | QKSPZPNYQCWUAJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|